C18H24O4 — CID 135007621
dimethyl (3aS,7aR)-4-cyclopentylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate (PubChem CID 135007621) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is dimethyl (3aS,7aR)-4-cyclopentylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,7aR)-4-cyclopentylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135007621 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | dimethyl (3aS,7aR)-4-cyclopentylidene-3,3a,5,7a-tetrahydro-1H-indene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2C(=C3CCCC3)CC=C[C@H]2C1 |
| InChI | InChI=1S/C18H24O4/c1-21-16(19)18(17(20)22-2)10-13-8-5-9-14(15(13)11-18)12-6-3-4-7-12/h5,8,13,15H,3-4,6-7,9-11H2,1-2H3/t13-,15-/m0/s1 |
| InChIKey | NCKROTPIYKGUNY-ZFWWWQNUSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|