C16H29ClO4Si — CID 135007967
tert-butyl 2-[(4R,6S)-6-[(E)-2-[chloro(dimethyl)silyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 135007967) has the molecular formula C16H29ClO4Si and a molecular weight of 348.94 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-6-[(E)-2-[chloro(dimethyl)silyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-6-[(E)-2-[chloro(dimethyl)silyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 135007967 |
| Molecular Formula | C16H29ClO4Si |
| Molecular Weight | 348.94 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-6-[(E)-2-[chloro(dimethyl)silyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](/C=C/[Si](C)(C)Cl)OC(C)(C)O1 |
| InChI | InChI=1S/C16H29ClO4Si/c1-15(2,3)21-14(18)11-13-10-12(8-9-22(6,7)17)19-16(4,5)20-13/h8-9,12-13H,10-11H2,1-7H3/b9-8+/t12-,13-/m1/s1 |
| InChIKey | LRRMNRPGEKIWLO-RYYBZQDPSA-N |
| XLogP | 4.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|