C8H5F9N2O2S — CID 135008871
1,1,2,2,3,3,4,4,4-nonafluoro-N-(1H-pyrrol-3-yl)butane-1-sulfonamide (PubChem CID 135008871) has the molecular formula C8H5F9N2O2S and a molecular weight of 364.19 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-(1H-pyrrol-3-yl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(1H-pyrrol-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 135008871 |
| Molecular Formula | C8H5F9N2O2S |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(1H-pyrrol-3-yl)butane-1-sulfonamide |
| SMILES | O=S(=O)(Nc1cc[nH]c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9N2O2S/c9-5(10,7(13,14)15)6(11,12)8(16,17)22(20,21)19-4-1-2-18-3-4/h1-3,18-19H |
| InChIKey | NFCMSDQWSSBYID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|