C10H15NO3 — CID 135009610
ethyl (Z,2E)-2-(1-aminoethylidene)-5-oxohex-3-enoate (PubChem CID 135009610) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl (Z,2E)-2-(1-aminoethylidene)-5-oxohex-3-enoate.
| Compound Name | ethyl (Z,2E)-2-(1-aminoethylidene)-5-oxohex-3-enoate |
|---|---|
| PubChem CID | 135009610 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethyl (Z,2E)-2-(1-aminoethylidene)-5-oxohex-3-enoate |
| SMILES | CCOC(=O)C(/C=C\C(C)=O)=C(\C)N |
| InChI | InChI=1S/C10H15NO3/c1-4-14-10(13)9(8(3)11)6-5-7(2)12/h5-6H,4,11H2,1-3H3/b6-5-,9-8+ |
| InChIKey | XXRDDGQNONDWQF-UEPDSTOUSA-N |
| XLogP | 0.93 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|