C9H10F3NO3 — CID 2779399
methyl (2Z)-2-(1-aminoethylidene)-6,6,6-trifluoro-5-oxohex-3-enoate (PubChem CID 2779399) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is methyl (2Z)-2-(1-aminoethylidene)-6,6,6-trifluoro-5-oxohex-3-enoate.
| Compound Name | methyl (2Z)-2-(1-aminoethylidene)-6,6,6-trifluoro-5-oxohex-3-enoate |
|---|---|
| PubChem CID | 2779399 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | methyl (2Z)-2-(1-aminoethylidene)-6,6,6-trifluoro-5-oxohex-3-enoate |
| SMILES | COC(=O)/C(C=CC(=O)C(F)(F)F)=C(/C)N |
| InChI | InChI=1S/C9H10F3NO3/c1-5(13)6(8(15)16-2)3-4-7(14)9(10,11)12/h3-4H,13H2,1-2H3/b4-3?,6-5- |
| InChIKey | CAPMVVIFURWOMI-FHMHXFBPSA-N |
| XLogP | 1.08 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|