About ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate
ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 135009612) has the molecular formula C18H17NO5S
and a molecular weight of 359.40 g/mol. Its IUPAC name is ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| PubChem CID | 135009612 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)C1CSC(c2ccc(COC(=O)c3ccccc3)o2)=N1 |
| InChI | InChI=1S/C18H17NO5S/c1-2-22-18(21)14-11-25-16(19-14)15-9-8-13(24-15)10-23-17(20)12-6-4-3-5-7-12/h3-9,14H,2,10-11H2,1H3 |
| InChIKey | WOTZXDQDUPRTLM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate (CID 135009612) is ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate is CCOC(=O)C1CSC(c2ccc(COC(=O)c3ccccc3)o2)=N1.
What is the InChIKey of ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate?
The InChIKey is WOTZXDQDUPRTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO5S/c1-2-22-18(21)14-11-25-16(19-14)15-9-8-13(24-15)10-23-17(20)12-6-4-3-5-7-12/h3-9,14H,2,10-11H2,1H3.
What are the key properties of ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate?
ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate has a molecular weight of 359.40 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-(benzoyloxymethyl)furan-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 135009612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).