C25H27Cl3N2O3 — CID 135009695
N-cyclohexyl-3-(4-methylphenyl)-2-(4-methyl-N-(2,2,2-trichloroacetyl)anilino)-3-oxopropanamide (PubChem CID 135009695) has the molecular formula C25H27Cl3N2O3 and a molecular weight of 509.86 g/mol. Its IUPAC name is N-cyclohexyl-3-(4-methylphenyl)-2-(4-methyl-N-(2,2,2-trichloroacetyl)anilino)-3-oxopropanamide.
| Compound Name | N-cyclohexyl-3-(4-methylphenyl)-2-(4-methyl-N-(2,2,2-trichloroacetyl)anilino)-3-oxopropanamide |
|---|---|
| PubChem CID | 135009695 |
| Molecular Formula | C25H27Cl3N2O3 |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-cyclohexyl-3-(4-methylphenyl)-2-(4-methyl-N-(2,2,2-trichloroacetyl)anilino)-3-oxopropanamide |
| SMILES | Cc1ccc(C(=O)C(C(=O)NC2CCCCC2)N(C(=O)C(Cl)(Cl)Cl)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H27Cl3N2O3/c1-16-8-12-18(13-9-16)22(31)21(23(32)29-19-6-4-3-5-7-19)30(24(33)25(26,27)28)20-14-10-17(2)11-15-20/h8-15,19,21H,3-7H2,1-2H3,(H,29,32) |
| InChIKey | QFJOUHLHOCVJDF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|