C29H26Cl2N2O4 — CID 11284070
2-(3-chloro-N-(2-oxo-2-phenylacetyl)anilino)-3-(4-chlorophenyl)-N-cyclohexyl-3-oxopropanamide (PubChem CID 11284070) has the molecular formula C29H26Cl2N2O4 and a molecular weight of 537.44 g/mol. Its IUPAC name is 2-(3-chloro-N-(2-oxo-2-phenylacetyl)anilino)-3-(4-chlorophenyl)-N-cyclohexyl-3-oxopropanamide.
| Compound Name | 2-(3-chloro-N-(2-oxo-2-phenylacetyl)anilino)-3-(4-chlorophenyl)-N-cyclohexyl-3-oxopropanamide |
|---|---|
| PubChem CID | 11284070 |
| Molecular Formula | C29H26Cl2N2O4 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-(3-chloro-N-(2-oxo-2-phenylacetyl)anilino)-3-(4-chlorophenyl)-N-cyclohexyl-3-oxopropanamide |
| SMILES | O=C(C(=O)N(c1cccc(Cl)c1)C(C(=O)NC1CCCCC1)C(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H26Cl2N2O4/c30-21-16-14-20(15-17-21)26(34)25(28(36)32-23-11-5-2-6-12-23)33(24-13-7-10-22(31)18-24)29(37)27(35)19-8-3-1-4-9-19/h1,3-4,7-10,13-18,23,25H,2,5-6,11-12H2,(H,32,36) |
| InChIKey | GHHQTVXFSUQFSF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|