C21H25NO — CID 135009825
1,3,3-trimethyl-2-(6-phenyl-2-pyridinyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 135009825) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-(6-phenyl-2-pyridinyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | 1,3,3-trimethyl-2-(6-phenyl-2-pyridinyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 135009825 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1,3,3-trimethyl-2-(6-phenyl-2-pyridinyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | CC12CCC(C1)C(C)(C)C2(O)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H25NO/c1-19(2)16-12-13-20(3,14-16)21(19,23)18-11-7-10-17(22-18)15-8-5-4-6-9-15/h4-11,16,23H,12-14H2,1-3H3 |
| InChIKey | DLGYWCMWKFWAGL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |