About N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine
N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine (PubChem CID 135009834) has the molecular formula C17H39N3O6P2
and a molecular weight of 443.46 g/mol. Its IUPAC name is N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine.
Molecular Properties
| Compound Name | N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine |
| PubChem CID | 135009834 |
| Molecular Formula | C17H39N3O6P2 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine |
| SMILES | CCOP(=O)(OCC)C(C)CC(NN1CCN(C)CC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H39N3O6P2/c1-7-23-27(21,24-8-2)16(5)15-17(28(22,25-9-3)26-10-4)18-20-13-11-19(6)12-14-20/h16-18H,7-15H2,1-6H3 |
| InChIKey | ZERQEEZEPQBFLR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine?
The IUPAC name of N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine (CID 135009834) is N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine.
What is the SMILES notation for N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine?
The canonical SMILES for N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine is CCOP(=O)(OCC)C(C)CC(NN1CCN(C)CC1)P(=O)(OCC)OCC.
What is the InChIKey of N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine?
The InChIKey is ZERQEEZEPQBFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39N3O6P2/c1-7-23-27(21,24-8-2)16(5)15-17(28(22,25-9-3)26-10-4)18-20-13-11-19(6)12-14-20/h16-18H,7-15H2,1-6H3.
What are the key properties of N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine?
N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine has a molecular weight of 443.46 g/mol, XLogP of 3.38, 14 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-bis(diethoxyphosphoryl)butyl]-4-methylpiperazin-1-amine is sourced from PubChem (CID 135009834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).