C15H31OSi2- — CID 135010036
trans-(1R,2R)-2-[(E)-1,3-bis(trimethylsilyl)prop-2-enyl]cyclohexan-1-olate (PubChem CID 135010036) has the molecular formula C15H31OSi2- and a molecular weight of 283.58 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(E)-1,3-bis(trimethylsilyl)prop-2-enyl]cyclohexan-1-olate.
| Compound Name | trans-(1R,2R)-2-[(E)-1,3-bis(trimethylsilyl)prop-2-enyl]cyclohexan-1-olate |
|---|---|
| PubChem CID | 135010036 |
| Molecular Formula | C15H31OSi2- |
| Molecular Weight | 283.58 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | trans-(1R,2R)-2-[(E)-1,3-bis(trimethylsilyl)prop-2-enyl]cyclohexan-1-olate |
| SMILES | C[Si](C)(C)/C=C/C([C@@H]1CCCC[C@H]1[O-])[Si](C)(C)C |
| InChI | InChI=1S/C15H31OSi2/c1-17(2,3)12-11-15(18(4,5)6)13-9-7-8-10-14(13)16/h11-15H,7-10H2,1-6H3/q-1/b12-11+/t13-,14-,15?/m1/s1 |
| InChIKey | VVGCZMPTYPSYAQ-PHUNFVIHSA-N |
| XLogP | 4.05 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|