C7H11IO2 — CID 135010236
(Z)-5-iodo-4-methyl-2-methylidenepent-4-ene-1,3-diol (PubChem CID 135010236) has the molecular formula C7H11IO2 and a molecular weight of 254.07 g/mol. Its IUPAC name is (Z)-5-iodo-4-methyl-2-methylidenepent-4-ene-1,3-diol.
| Compound Name | (Z)-5-iodo-4-methyl-2-methylidenepent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 135010236 |
| Molecular Formula | C7H11IO2 |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | (Z)-5-iodo-4-methyl-2-methylidenepent-4-ene-1,3-diol |
| SMILES | C=C(CO)C(O)/C(C)=C\I |
| InChI | InChI=1S/C7H11IO2/c1-5(3-8)7(10)6(2)4-9/h3,7,9-10H,2,4H2,1H3/b5-3- |
| InChIKey | KVJKEAVQAARDGJ-HYXAFXHYSA-N |
| XLogP | 1.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|