C28H42O5Si — CID 135010499
ethyl (3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-5-[(1R,2S,4S,5S,6S,7S)-3-oxo-5-prop-1-en-2-yl-4-tricyclo[5.2.1.02,6]dec-8-enyl]cyclopentane-1-carboxylate (PubChem CID 135010499) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is ethyl (3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-5-[(1R,2S,4S,5S,6S,7S)-3-oxo-5-prop-1-en-2-yl-4-tricyclo[5.2.1.02,6]dec-8-enyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl (3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-5-[(1R,2S,4S,5S,6S,7S)-3-oxo-5-prop-1-en-2-yl-4-tricyclo[5.2.1.02,6]dec-8-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 135010499 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | ethyl (3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-oxo-5-[(1R,2S,4S,5S,6S,7S)-3-oxo-5-prop-1-en-2-yl-4-tricyclo[5.2.1.02,6]dec-8-enyl]cyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1[C@@H]([C@@H]2C(C(=O)OCC)C(=O)[C@H](C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C28H42O5Si/c1-10-32-27(31)23-22(26(15(4)24(23)29)33-34(8,9)28(5,6)7)21-18(14(2)3)19-16-11-12-17(13-16)20(19)25(21)30/h11-12,15-23,26H,2,10,13H2,1,3-9H3/t15-,16+,17-,18-,19-,20-,21-,22+,23?,26+/m0/s1 |
| InChIKey | MFMCVSRDAHRBBY-QWSFLKDOSA-N |
| XLogP | 5.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|