C16H19NO2 — CID 135010587
(3aR,8bS)-3,3,4-trimethyl-8b-prop-2-enyl-3aH-furo[3,4-b]indol-1-one (PubChem CID 135010587) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3aR,8bS)-3,3,4-trimethyl-8b-prop-2-enyl-3aH-furo[3,4-b]indol-1-one.
| Compound Name | (3aR,8bS)-3,3,4-trimethyl-8b-prop-2-enyl-3aH-furo[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 135010587 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3aR,8bS)-3,3,4-trimethyl-8b-prop-2-enyl-3aH-furo[3,4-b]indol-1-one |
| SMILES | C=CC[C@@]12C(=O)OC(C)(C)[C@@H]1N(C)c1ccccc12 |
| InChI | InChI=1S/C16H19NO2/c1-5-10-16-11-8-6-7-9-12(11)17(4)13(16)15(2,3)19-14(16)18/h5-9,13H,1,10H2,2-4H3/t13-,16-/m0/s1 |
| InChIKey | BNJAMQYYCCUJIP-BBRMVZONSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|