C19H15NO3 — CID 135011112
(3S)-1-benzyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione (PubChem CID 135011112) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3S)-1-benzyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione.
| Compound Name | (3S)-1-benzyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 135011112 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (3S)-1-benzyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione |
| SMILES | C=C1C(=O)OC[C@@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C19H15NO3/c1-13-17(21)23-12-19(13)15-9-5-6-10-16(15)20(18(19)22)11-14-7-3-2-4-8-14/h2-10H,1,11-12H2/t19-/m1/s1 |
| InChIKey | HLMYQYQXOWDQRO-LJQANCHMSA-N |
| XLogP | 2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|