C17H12FNO3 — CID 154714580
(3aS,8bR)-4-benzoyl-8b-fluoro-1,3a-dihydrofuro[2,3-b]indol-2-one (PubChem CID 154714580) has the molecular formula C17H12FNO3 and a molecular weight of 297.29 g/mol. Its IUPAC name is (3aS,8bR)-4-benzoyl-8b-fluoro-1,3a-dihydrofuro[2,3-b]indol-2-one.
| Compound Name | (3aS,8bR)-4-benzoyl-8b-fluoro-1,3a-dihydrofuro[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 154714580 |
| Molecular Formula | C17H12FNO3 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (3aS,8bR)-4-benzoyl-8b-fluoro-1,3a-dihydrofuro[2,3-b]indol-2-one |
| SMILES | O=C1C[C@@]2(F)c3ccccc3N(C(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H12FNO3/c18-17-10-14(20)22-16(17)19(13-9-5-4-8-12(13)17)15(21)11-6-2-1-3-7-11/h1-9,16H,10H2/t16-,17+/m0/s1 |
| InChIKey | FJLDAKOVWJIPEM-DLBZAZTESA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |