C16H17NO2 — CID 134948176
(3aS,8bS)-4,8b-bis(prop-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one (PubChem CID 134948176) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (3aS,8bS)-4,8b-bis(prop-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one.
| Compound Name | (3aS,8bS)-4,8b-bis(prop-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 134948176 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (3aS,8bS)-4,8b-bis(prop-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one |
| SMILES | C=CCN1c2ccccc2[C@]2(CC=C)CC(=O)O[C@H]12 |
| InChI | InChI=1S/C16H17NO2/c1-3-9-16-11-14(18)19-15(16)17(10-4-2)13-8-6-5-7-12(13)16/h3-8,15H,1-2,9-11H2/t15-,16-/m0/s1 |
| InChIKey | SBWYEJFLJFRHNW-HOTGVXAUSA-N |
| XLogP | 2.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|