C10H22N2O — CID 135011279
[(2R,5S)-1,4-dimethyl-5-propan-2-ylpiperazin-2-yl]methanol (PubChem CID 135011279) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is [(2R,5S)-1,4-dimethyl-5-propan-2-ylpiperazin-2-yl]methanol.
| Compound Name | [(2R,5S)-1,4-dimethyl-5-propan-2-ylpiperazin-2-yl]methanol |
|---|---|
| PubChem CID | 135011279 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | [(2R,5S)-1,4-dimethyl-5-propan-2-ylpiperazin-2-yl]methanol |
| SMILES | CC(C)[C@H]1CN(C)[C@@H](CO)CN1C |
| InChI | InChI=1S/C10H22N2O/c1-8(2)10-6-11(3)9(7-13)5-12(10)4/h8-10,13H,5-7H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | RICAUZWWXSFYCA-NXEZZACHSA-N |
| XLogP | 0.25 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |