C16H20ClNO2 — CID 135011430
tert-butyl N-[(2E)-5-(4-chlorophenyl)penta-2,4-dienyl]carbamate (PubChem CID 135011430) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is tert-butyl N-[(2E)-5-(4-chlorophenyl)penta-2,4-dienyl]carbamate.
| Compound Name | tert-butyl N-[(2E)-5-(4-chlorophenyl)penta-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 135011430 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | tert-butyl N-[(2E)-5-(4-chlorophenyl)penta-2,4-dienyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO2/c1-16(2,3)20-15(19)18-12-6-4-5-7-13-8-10-14(17)11-9-13/h4-11H,12H2,1-3H3,(H,18,19)/b6-4+,7-5? |
| InChIKey | DDYACYBLNNEMAJ-NNUXYFOWSA-N |
| XLogP | 4.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|