C14H19ClN2O2 — CID 2795723
tert-butyl N-[2-[(4-chlorophenyl)methylideneamino]ethyl]carbamate (PubChem CID 2795723) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-chlorophenyl)methylideneamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-chlorophenyl)methylideneamino]ethyl]carbamate |
|---|---|
| PubChem CID | 2795723 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | tert-butyl N-[2-[(4-chlorophenyl)methylideneamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-14(2,3)19-13(18)17-9-8-16-10-11-4-6-12(15)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,17,18)/b16-10+ |
| InChIKey | QMASBNMLQSLPTE-MHWRWJLKSA-N |
| XLogP | 3.28 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|