C14H17ClFNO2 — CID 169467061
tert-butyl N-[3-(4-chloro-3-fluorophenyl)prop-2-enyl]carbamate (PubChem CID 169467061) has the molecular formula C14H17ClFNO2 and a molecular weight of 285.75 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-3-fluorophenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-3-fluorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467061 |
| Molecular Formula | C14H17ClFNO2 |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-3-fluorophenyl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H17ClFNO2/c1-14(2,3)19-13(18)17-8-4-5-10-6-7-11(15)12(16)9-10/h4-7,9H,8H2,1-3H3,(H,17,18) |
| InChIKey | HAXAQIHNGNBZJU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |