C15H18ClNO2 — CID 138974492
tert-butyl N-[4-(4-chlorophenyl)buta-2,3-dienyl]carbamate (PubChem CID 138974492) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is tert-butyl N-[4-(4-chlorophenyl)buta-2,3-dienyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-chlorophenyl)buta-2,3-dienyl]carbamate |
|---|---|
| PubChem CID | 138974492 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | tert-butyl N-[4-(4-chlorophenyl)buta-2,3-dienyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO2/c1-15(2,3)19-14(18)17-11-5-4-6-12-7-9-13(16)10-8-12/h5-10H,11H2,1-3H3,(H,17,18) |
| InChIKey | QMQKTOGDKOELAU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |