C15H19Cl2NO3S2 — CID 162649255
tert-butyl N-[2-[(2,4-dichlorophenyl)methylsulfanylcarbonylsulfanyl]ethyl]carbamate (PubChem CID 162649255) has the molecular formula C15H19Cl2NO3S2 and a molecular weight of 396.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,4-dichlorophenyl)methylsulfanylcarbonylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,4-dichlorophenyl)methylsulfanylcarbonylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 162649255 |
| Molecular Formula | C15H19Cl2NO3S2 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | tert-butyl N-[2-[(2,4-dichlorophenyl)methylsulfanylcarbonylsulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSC(=O)SCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2NO3S2/c1-15(2,3)21-13(19)18-6-7-22-14(20)23-9-10-4-5-11(16)8-12(10)17/h4-5,8H,6-7,9H2,1-3H3,(H,18,19) |
| InChIKey | UMWHIFLWHGPZCJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|