C12H12Cl2F3NO2S — CID 56583684
2,2,2-trifluoroethyl N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]carbamate (PubChem CID 56583684) has the molecular formula C12H12Cl2F3NO2S and a molecular weight of 362.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56583684 |
| Molecular Formula | C12H12Cl2F3NO2S |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]carbamate |
| SMILES | O=C(NCCSCc1c(Cl)cccc1Cl)OCC(F)(F)F |
| InChI | InChI=1S/C12H12Cl2F3NO2S/c13-9-2-1-3-10(14)8(9)6-21-5-4-18-11(19)20-7-12(15,16)17/h1-3H,4-7H2,(H,18,19) |
| InChIKey | JLQHYFWLLHUIPX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|