C22H25Cl2F2NO2S2 — CID 2805336
1,3-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]propan-2-yl N-butylcarbamate (PubChem CID 2805336) has the molecular formula C22H25Cl2F2NO2S2 and a molecular weight of 508.48 g/mol. Its IUPAC name is 1,3-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]propan-2-yl N-butylcarbamate.
| Compound Name | 1,3-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]propan-2-yl N-butylcarbamate |
|---|---|
| PubChem CID | 2805336 |
| Molecular Formula | C22H25Cl2F2NO2S2 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | 1,3-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]propan-2-yl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC(CSCc1c(F)cccc1Cl)CSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C22H25Cl2F2NO2S2/c1-2-3-10-27-22(28)29-15(11-30-13-16-18(23)6-4-8-20(16)25)12-31-14-17-19(24)7-5-9-21(17)26/h4-9,15H,2-3,10-14H2,1H3,(H,27,28) |
| InChIKey | ZTKAICLWGJDSTR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|