C13H17Cl2NO2 — CID 63787795
tert-butyl N-[2-(2,4-dichlorophenyl)ethyl]carbamate (PubChem CID 63787795) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is tert-butyl N-[2-(2,4-dichlorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,4-dichlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 63787795 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | tert-butyl N-[2-(2,4-dichlorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c1-13(2,3)18-12(17)16-7-6-9-4-5-10(14)8-11(9)15/h4-5,8H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | UKBDQPTXHBMGQF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |