C15H21NO3S2 — CID 162645144
tert-butyl N-(2-benzylsulfanylcarbonylsulfanylethyl)carbamate (PubChem CID 162645144) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-(2-benzylsulfanylcarbonylsulfanylethyl)carbamate.
| Compound Name | tert-butyl N-(2-benzylsulfanylcarbonylsulfanylethyl)carbamate |
|---|---|
| PubChem CID | 162645144 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | tert-butyl N-(2-benzylsulfanylcarbonylsulfanylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSC(=O)SCc1ccccc1 |
| InChI | InChI=1S/C15H21NO3S2/c1-15(2,3)19-13(17)16-9-10-20-14(18)21-11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,16,17) |
| InChIKey | GOIFXKRFCGQMSQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|