C15H22ClNO3S — CID 14476748
tert-butyl N-[(2S)-1-(chloromethylsulfinyl)-3-phenylpropan-2-yl]carbamate (PubChem CID 14476748) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(chloromethylsulfinyl)-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(chloromethylsulfinyl)-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 14476748 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | tert-butyl N-[(2S)-1-(chloromethylsulfinyl)-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)CS(=O)CCl |
| InChI | InChI=1S/C15H22ClNO3S/c1-15(2,3)20-14(18)17-13(10-21(19)11-16)9-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,17,18)/t13-,21?/m0/s1 |
| InChIKey | DYTWUWBQYXNCQT-JRTLGTJJSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|