C14H16Cl2FNO2 — CID 169468686
tert-butyl N-[3-(2,4-dichloro-5-fluorophenyl)prop-2-enyl]carbamate (PubChem CID 169468686) has the molecular formula C14H16Cl2FNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is tert-butyl N-[3-(2,4-dichloro-5-fluorophenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,4-dichloro-5-fluorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468686 |
| Molecular Formula | C14H16Cl2FNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | tert-butyl N-[3-(2,4-dichloro-5-fluorophenyl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2FNO2/c1-14(2,3)20-13(19)18-6-4-5-9-7-12(17)11(16)8-10(9)15/h4-5,7-8H,6H2,1-3H3,(H,18,19) |
| InChIKey | GAIPTJQDSVGVHL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|