C15H19ClFNO2 — CID 66982992
tert-butyl N-[2-[(3-chlorophenyl)methyl]-3-fluoroprop-2-enyl]carbamate (PubChem CID 66982992) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-chlorophenyl)methyl]-3-fluoroprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-chlorophenyl)methyl]-3-fluoroprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 66982992 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | tert-butyl N-[2-[(3-chlorophenyl)methyl]-3-fluoroprop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=CF)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClFNO2/c1-15(2,3)20-14(19)18-10-12(9-17)7-11-5-4-6-13(16)8-11/h4-6,8-9H,7,10H2,1-3H3,(H,18,19) |
| InChIKey | DCYCZLAEQFNLEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |