C16H30O4Si — CID 135011853
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R,2R)-2-hydroxy-3,3-dimethylcyclobutyl]oxolan-2-one (PubChem CID 135011853) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R,2R)-2-hydroxy-3,3-dimethylcyclobutyl]oxolan-2-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R,2R)-2-hydroxy-3,3-dimethylcyclobutyl]oxolan-2-one |
|---|---|
| PubChem CID | 135011853 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R,2R)-2-hydroxy-3,3-dimethylcyclobutyl]oxolan-2-one |
| SMILES | CC1(C)C[C@H](C2C(=O)OC[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C16H30O4Si/c1-15(2,3)21(6,7)20-11-9-19-14(18)12(11)10-8-16(4,5)13(10)17/h10-13,17H,8-9H2,1-7H3/t10-,11-,12?,13-/m1/s1 |
| InChIKey | QUGDVUNCLJHOLV-ZHRBOBAGSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|