C20H28O6 — CID 135011949
(5E,10R,15E,20R)-10,20-dimethyl-1,11-dioxacycloicosa-5,15-diene-2,4,12,14-tetrone (PubChem CID 135011949) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (5E,10R,15E,20R)-10,20-dimethyl-1,11-dioxacycloicosa-5,15-diene-2,4,12,14-tetrone.
| Compound Name | (5E,10R,15E,20R)-10,20-dimethyl-1,11-dioxacycloicosa-5,15-diene-2,4,12,14-tetrone |
|---|---|
| PubChem CID | 135011949 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (5E,10R,15E,20R)-10,20-dimethyl-1,11-dioxacycloicosa-5,15-diene-2,4,12,14-tetrone |
| SMILES | C[C@@H]1CCC/C=C/C(=O)CC(=O)O[C@H](C)CCC/C=C/C(=O)CC(=O)O1 |
| InChI | InChI=1S/C20H28O6/c1-15-9-5-3-7-11-18(22)14-20(24)26-16(2)10-6-4-8-12-17(21)13-19(23)25-15/h7-8,11-12,15-16H,3-6,9-10,13-14H2,1-2H3/b11-7+,12-8+/t15-,16-/m1/s1 |
| InChIKey | XNWYPNMAUAMVDJ-BATNXWGKSA-N |
| XLogP | 3.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|