C17H17NO4 — CID 135012209
methyl 2-(1-ethyl-2-oxo-3H-indol-3-yl)-2-formylpenta-3,4-dienoate (PubChem CID 135012209) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 2-(1-ethyl-2-oxo-3H-indol-3-yl)-2-formylpenta-3,4-dienoate.
| Compound Name | methyl 2-(1-ethyl-2-oxo-3H-indol-3-yl)-2-formylpenta-3,4-dienoate |
|---|---|
| PubChem CID | 135012209 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 2-(1-ethyl-2-oxo-3H-indol-3-yl)-2-formylpenta-3,4-dienoate |
| SMILES | C=C=CC(C=O)(C(=O)OC)C1C(=O)N(CC)c2ccccc21 |
| InChI | InChI=1S/C17H17NO4/c1-4-10-17(11-19,16(21)22-3)14-12-8-6-7-9-13(12)18(5-2)15(14)20/h6-11,14H,1,5H2,2-3H3 |
| InChIKey | MFLAFDHIYNIARF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|