C17H23N3O3 — CID 135012239
2-[1-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]ethylideneamino]acetic acid (PubChem CID 135012239) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[1-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]ethylideneamino]acetic acid.
| Compound Name | 2-[1-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]ethylideneamino]acetic acid |
|---|---|
| PubChem CID | 135012239 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-[1-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]ethylideneamino]acetic acid |
| SMILES | C/C(=N\CC(=O)O)c1ccccc1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C17H23N3O3/c1-13(18-11-17(22)23)14-7-3-4-8-15(14)19-16(21)12-20-9-5-2-6-10-20/h3-4,7-8H,2,5-6,9-12H2,1H3,(H,19,21)(H,22,23)/b18-13+ |
| InChIKey | RDYLWEDZJLFSOF-QGOAFFKASA-N |
| XLogP | 2.00 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|