C17H22O5 — CID 135012327
ethyl 2-[(4R,5R,7S)-7-ethoxy-2,8-dioxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-4-yl]acetate (PubChem CID 135012327) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl 2-[(4R,5R,7S)-7-ethoxy-2,8-dioxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,5R,7S)-7-ethoxy-2,8-dioxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-4-yl]acetate |
|---|---|
| PubChem CID | 135012327 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | ethyl 2-[(4R,5R,7S)-7-ethoxy-2,8-dioxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1COc2cccc3c2[C@@H]1C[C@@H](OCC)O3 |
| InChI | InChI=1S/C17H22O5/c1-3-19-15(18)8-11-10-21-13-6-5-7-14-17(13)12(11)9-16(22-14)20-4-2/h5-7,11-12,16H,3-4,8-10H2,1-2H3/t11-,12+,16-/m0/s1 |
| InChIKey | SXNGTQKDZVJZRJ-OZVIIMIRSA-N |
| XLogP | 2.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |