C20H25N3O3 — CID 135012333
(1R,4S,7S,9S)-9-hydroxy-4,5-dimethyl-16-(2-methylbut-3-en-2-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 135012333) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (1R,4S,7S,9S)-9-hydroxy-4,5-dimethyl-16-(2-methylbut-3-en-2-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1R,4S,7S,9S)-9-hydroxy-4,5-dimethyl-16-(2-methylbut-3-en-2-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 135012333 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (1R,4S,7S,9S)-9-hydroxy-4,5-dimethyl-16-(2-methylbut-3-en-2-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | C=CC(C)(C)N1c2ccccc2[C@@]2(O)C[C@H]3C(=O)N(C)[C@@H](C)C(=O)N3[C@@H]12 |
| InChI | InChI=1S/C20H25N3O3/c1-6-19(3,4)23-14-10-8-7-9-13(14)20(26)11-15-17(25)21(5)12(2)16(24)22(15)18(20)23/h6-10,12,15,18,26H,1,11H2,2-5H3/t12-,15-,18-,20-/m0/s1 |
| InChIKey | CZUDJGHFHGEADU-IBBHNLMTSA-N |
| XLogP | 1.45 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|