C14H12S2 — CID 135013503
(3S,11S)-2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(16),4,6,8,12,14-hexaene (PubChem CID 135013503) has the molecular formula C14H12S2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (3S,11S)-2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(16),4,6,8,12,14-hexaene.
| Compound Name | (3S,11S)-2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(16),4,6,8,12,14-hexaene |
|---|---|
| PubChem CID | 135013503 |
| Molecular Formula | C14H12S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | (3S,11S)-2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(16),4,6,8,12,14-hexaene |
| SMILES | C1=CC=C2S[C@H]3C=CC=CC=C3S[C@H]2C=C1 |
| InChI | InChI=1S/C14H12S2/c1-3-7-11-12(8-4-1)16-14-10-6-2-5-9-13(14)15-11/h1-11,14H/t11-,14-/m0/s1 |
| InChIKey | ZRSRUUZCCNKVSW-FZMZJTMJSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |