C24H27NO4 — CID 135013529
(4R)-4-benzyl-3-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 135013529) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135013529 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@H](OCc1ccccc1)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H27NO4/c1-17(2)22(28-15-20-12-8-5-9-13-20)18(3)23(26)25-21(16-29-24(25)27)14-19-10-6-4-7-11-19/h4-13,18,21-22H,1,14-16H2,2-3H3/t18-,21-,22+/m1/s1 |
| InChIKey | MVEIDORSOABNLZ-QIJUGHKUSA-N |
| XLogP | 4.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|