C15H16O5S — CID 135013584
(2S)-2-[(2S)-5-(benzenesulfonyl)-4-oxopentan-2-yl]-2H-furan-5-one (PubChem CID 135013584) has the molecular formula C15H16O5S and a molecular weight of 308.35 g/mol. Its IUPAC name is (2S)-2-[(2S)-5-(benzenesulfonyl)-4-oxopentan-2-yl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(2S)-5-(benzenesulfonyl)-4-oxopentan-2-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 135013584 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (2S)-2-[(2S)-5-(benzenesulfonyl)-4-oxopentan-2-yl]-2H-furan-5-one |
| SMILES | C[C@@H](CC(=O)CS(=O)(=O)c1ccccc1)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C15H16O5S/c1-11(14-7-8-15(17)20-14)9-12(16)10-21(18,19)13-5-3-2-4-6-13/h2-8,11,14H,9-10H2,1H3/t11-,14+/m0/s1 |
| InChIKey | UNTQXNGLUWWKPY-SMDDNHRTSA-N |
| XLogP | 1.54 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |