C20H33N3O6 — CID 135013904
methyl (3R)-9-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate (PubChem CID 135013904) has the molecular formula C20H33N3O6 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl (3R)-9-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate.
| Compound Name | methyl (3R)-9-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
|---|---|
| PubChem CID | 135013904 |
| Molecular Formula | C20H33N3O6 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | methyl (3R)-9-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
| SMILES | COC(=O)C[C@@H](CCCCCCn1cc(C)c(=O)[nH]c1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33N3O6/c1-14-13-23(18(26)22-17(14)25)11-9-7-6-8-10-15(12-16(24)28-5)21-19(27)29-20(2,3)4/h13,15H,6-12H2,1-5H3,(H,21,27)(H,22,25,26)/t15-/m1/s1 |
| InChIKey | WWTXBNBQYWVZJT-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|