C31H43NO4Si — CID 135013944
tert-butyl (2S)-2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 135013944) has the molecular formula C31H43NO4Si and a molecular weight of 521.77 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135013944 |
| Molecular Formula | C31H43NO4Si |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | tert-butyl (2S)-2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@H]1/C=C\CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H43NO4Si/c1-30(2,3)36-29(34)32-25(22-23-28(32)33)17-11-7-8-16-24-35-37(31(4,5)6,26-18-12-9-13-19-26)27-20-14-10-15-21-27/h9-15,17-21,25H,7-8,16,22-24H2,1-6H3/b17-11-/t25-/m1/s1 |
| InChIKey | UTHUOOOKURNIHY-ZIXDRAHYSA-N |
| XLogP | 6.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|