C20H32N2O — CID 135014110
(Z,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethyl-1-phenylhexan-1-imine (PubChem CID 135014110) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is (Z,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethyl-1-phenylhexan-1-imine.
| Compound Name | (Z,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethyl-1-phenylhexan-1-imine |
|---|---|
| PubChem CID | 135014110 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | (Z,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethyl-1-phenylhexan-1-imine |
| SMILES | CC[C@H](C)C[C@H](C)/C(=N/N1CCC[C@H]1COC)c1ccccc1 |
| InChI | InChI=1S/C20H32N2O/c1-5-16(2)14-17(3)20(18-10-7-6-8-11-18)21-22-13-9-12-19(22)15-23-4/h6-8,10-11,16-17,19H,5,9,12-15H2,1-4H3/b21-20-/t16-,17-,19-/m0/s1 |
| InChIKey | YGTFHRVUBUCPAK-NTBSTCHESA-N |
| XLogP | 4.57 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|