C24H38N2O2 — CID 10861994
(1E,2R,3S)-3-ethenyl-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-1-phenylhexan-2-ol (PubChem CID 10861994) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1E,2R,3S)-3-ethenyl-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-1-phenylhexan-2-ol.
| Compound Name | (1E,2R,3S)-3-ethenyl-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-1-phenylhexan-2-ol |
|---|---|
| PubChem CID | 10861994 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (1E,2R,3S)-3-ethenyl-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-1-phenylhexan-2-ol |
| SMILES | C=C[C@H](CCC)[C@@H](O)/C(=N/N1CCC[C@H]1C(CC)(CC)OC)c1ccccc1 |
| InChI | InChI=1S/C24H38N2O2/c1-6-14-19(7-2)23(27)22(20-15-11-10-12-16-20)25-26-18-13-17-21(26)24(8-3,9-4)28-5/h7,10-12,15-16,19,21,23,27H,2,6,8-9,13-14,17-18H2,1,3-5H3/b25-22+/t19-,21+,23-/m1/s1 |
| InChIKey | DNZPYQCRFSXQNV-AAIFRYLISA-N |
| XLogP | 5.02 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|