C22H34N2O2 — CID 134930585
(1E,2R,3R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3-methyl-1-phenylpent-4-en-2-ol (PubChem CID 134930585) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (1E,2R,3R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3-methyl-1-phenylpent-4-en-2-ol.
| Compound Name | (1E,2R,3R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3-methyl-1-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 134930585 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (1E,2R,3R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3-methyl-1-phenylpent-4-en-2-ol |
| SMILES | C=C[C@@H](C)[C@@H](O)/C(=N/N1CCC[C@H]1C(CC)(CC)OC)c1ccccc1 |
| InChI | InChI=1S/C22H34N2O2/c1-6-17(4)21(25)20(18-13-10-9-11-14-18)23-24-16-12-15-19(24)22(7-2,8-3)26-5/h6,9-11,13-14,17,19,21,25H,1,7-8,12,15-16H2,2-5H3/b23-20+/t17-,19+,21-/m1/s1 |
| InChIKey | UJSOAOLXCAGKQB-RBTQBCCPSA-N |
| XLogP | 4.24 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|