C18H24N2O2 — CID 73055851
(Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[(E)-3-phenylprop-2-enyl]oxetan-3-imine (PubChem CID 73055851) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[(E)-3-phenylprop-2-enyl]oxetan-3-imine.
| Compound Name | (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[(E)-3-phenylprop-2-enyl]oxetan-3-imine |
|---|---|
| PubChem CID | 73055851 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[(E)-3-phenylprop-2-enyl]oxetan-3-imine |
| SMILES | COC[C@@H]1CCCN1/N=C1/CO[C@H]1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c1-21-13-16-10-6-12-20(16)19-17-14-22-18(17)11-5-9-15-7-3-2-4-8-15/h2-5,7-9,16,18H,6,10-14H2,1H3/b9-5+,19-17-/t16-,18-/m0/s1 |
| InChIKey | JAMRRULBSXJLRR-ONVVBGKMSA-N |
| XLogP | 2.96 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|