C22H28N2O — CID 13283581
(E)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylbutan-2-imine (PubChem CID 13283581) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (E)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylbutan-2-imine.
| Compound Name | (E)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylbutan-2-imine |
|---|---|
| PubChem CID | 13283581 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (E)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,3-diphenylbutan-2-imine |
| SMILES | COCC1CCCN1/N=C(\Cc1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c1-18(20-12-7-4-8-13-20)22(16-19-10-5-3-6-11-19)23-24-15-9-14-21(24)17-25-2/h3-8,10-13,18,21H,9,14-17H2,1-2H3/b23-22+ |
| InChIKey | SSYMTPRVXAPJCT-GHVJWSGMSA-N |
| XLogP | 4.50 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|