C25H27N2OP — CID 10927540
(E)-1-(2-diphenylphosphanylphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine (PubChem CID 10927540) has the molecular formula C25H27N2OP and a molecular weight of 402.48 g/mol. Its IUPAC name is (E)-1-(2-diphenylphosphanylphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine.
| Compound Name | (E)-1-(2-diphenylphosphanylphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine |
|---|---|
| PubChem CID | 10927540 |
| Molecular Formula | C25H27N2OP |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (E)-1-(2-diphenylphosphanylphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine |
| SMILES | COC[C@@H]1CCCN1/N=C/c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N2OP/c1-28-20-22-12-10-18-27(22)26-19-21-11-8-9-17-25(21)29(23-13-4-2-5-14-23)24-15-6-3-7-16-24/h2-9,11,13-17,19,22H,10,12,18,20H2,1H3/b26-19+/t22-/m0/s1 |
| InChIKey | HWYHRYZQXAYOLA-HLELUFFISA-N |
| XLogP | 3.89 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|