C17H26N2O — CID 134866380
(Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenylbutan-1-imine (PubChem CID 134866380) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenylbutan-1-imine.
| Compound Name | (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenylbutan-1-imine |
|---|---|
| PubChem CID | 134866380 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-1-phenylbutan-1-imine |
| SMILES | CC[C@H](C)/C(=N/N1CCC[C@H]1COC)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O/c1-4-14(2)17(15-9-6-5-7-10-15)18-19-12-8-11-16(19)13-20-3/h5-7,9-10,14,16H,4,8,11-13H2,1-3H3/b18-17-/t14-,16-/m0/s1 |
| InChIKey | BWPUPXXDPGZMTN-DDZWBWQKSA-N |
| XLogP | 3.55 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|