C23H36N2O2 — CID 134880371
(1E,2R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3,3-dimethyl-1-phenylpent-4-en-2-ol (PubChem CID 134880371) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is (1E,2R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3,3-dimethyl-1-phenylpent-4-en-2-ol.
| Compound Name | (1E,2R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3,3-dimethyl-1-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 134880371 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (1E,2R)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-3,3-dimethyl-1-phenylpent-4-en-2-ol |
| SMILES | C=CC(C)(C)[C@@H](O)/C(=N/N1CCC[C@H]1C(CC)(CC)OC)c1ccccc1 |
| InChI | InChI=1S/C23H36N2O2/c1-7-22(4,5)21(26)20(18-14-11-10-12-15-18)24-25-17-13-16-19(25)23(8-2,9-3)27-6/h7,10-12,14-15,19,21,26H,1,8-9,13,16-17H2,2-6H3/b24-20+/t19-,21-/m0/s1 |
| InChIKey | CHMDWLVYPMOHPT-RSPPISFZSA-N |
| XLogP | 4.63 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|