C12H20O2 — CID 135014157
1-[(1R,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]ethanone (PubChem CID 135014157) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(1R,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]ethanone.
| Compound Name | 1-[(1R,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]ethanone |
|---|---|
| PubChem CID | 135014157 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1-[(1R,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]ethanone |
| SMILES | CC(=O)[C@@]1(O)C[C@H](C)CCC1=C(C)C |
| InChI | InChI=1S/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11,14)10(4)13/h9,14H,5-7H2,1-4H3/t9-,12+/m1/s1 |
| InChIKey | NREOKVPALSAZOT-SKDRFNHKSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|